C35H42N2O4Si — CID 154486212
[5-[4-[[6-[2-[tert-butyl(dimethyl)silyl]oxyethyl]naphthalen-2-yl]amino]-4-oxobutyl]-2-phenylphenyl]carbamic acid (PubChem CID 154486212) has the molecular formula C35H42N2O4Si and a molecular weight of 582.82 g/mol. Its IUPAC name is [5-[4-[[6-[2-[tert-butyl(dimethyl)silyl]oxyethyl]naphthalen-2-yl]amino]-4-oxobutyl]-2-phenylphenyl]carbamic acid.
| Compound Name | [5-[4-[[6-[2-[tert-butyl(dimethyl)silyl]oxyethyl]naphthalen-2-yl]amino]-4-oxobutyl]-2-phenylphenyl]carbamic acid |
|---|---|
| PubChem CID | 154486212 |
| Molecular Formula | C35H42N2O4Si |
| Molecular Weight | 582.82 g/mol |
| Exact Mass | 582.29 |
| IUPAC Name | [5-[4-[[6-[2-[tert-butyl(dimethyl)silyl]oxyethyl]naphthalen-2-yl]amino]-4-oxobutyl]-2-phenylphenyl]carbamic acid |
| SMILES | CC(C)(C)[Si](C)(C)OCCc1ccc2cc(NC(=O)CCCc3ccc(-c4ccccc4)c(NC(=O)O)c3)ccc2c1 |
| InChI | InChI=1S/C35H42N2O4Si/c1-35(2,3)42(4,5)41-21-20-26-14-16-29-24-30(18-17-28(29)22-26)36-33(38)13-9-10-25-15-19-31(27-11-7-6-8-12-27)32(23-25)37-34(39)40/h6-8,11-12,14-19,22-24,37H,9-10,13,20-21H2,1-5H3,(H,36,38)(H,39,40) |
| InChIKey | RNVZPHUEZAHFAG-UHFFFAOYSA-N |
| XLogP | 9.12 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.82 |
| LogP ≤ 5 | 9.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|