C31H39ClN2O5Si — CID 66596925
[5-[4-[4-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-chloro-5-methoxyanilino]-4-oxobutyl]-2-phenylphenyl]carbamic acid (PubChem CID 66596925) has the molecular formula C31H39ClN2O5Si and a molecular weight of 583.20 g/mol. Its IUPAC name is [5-[4-[4-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-chloro-5-methoxyanilino]-4-oxobutyl]-2-phenylphenyl]carbamic acid.
| Compound Name | [5-[4-[4-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-chloro-5-methoxyanilino]-4-oxobutyl]-2-phenylphenyl]carbamic acid |
|---|---|
| PubChem CID | 66596925 |
| Molecular Formula | C31H39ClN2O5Si |
| Molecular Weight | 583.20 g/mol |
| Exact Mass | 582.23 |
| IUPAC Name | [5-[4-[4-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-chloro-5-methoxyanilino]-4-oxobutyl]-2-phenylphenyl]carbamic acid |
| SMILES | COc1cc(NC(=O)CCCc2ccc(-c3ccccc3)c(NC(=O)O)c2)c(Cl)cc1CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C31H39ClN2O5Si/c1-31(2,3)40(5,6)39-20-23-18-25(32)27(19-28(23)38-4)33-29(35)14-10-11-21-15-16-24(22-12-8-7-9-13-22)26(17-21)34-30(36)37/h7-9,12-13,15-19,34H,10-11,14,20H2,1-6H3,(H,33,35)(H,36,37) |
| InChIKey | NNGCJXSJDHCUSI-UHFFFAOYSA-N |
| XLogP | 8.59 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.20 |
| LogP ≤ 5 | 8.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|