C38H50ClN3O5 — CID 90239803
[5-[4-[2-chloro-4-(hydroxymethyl)-5-methoxyanilino]-4-oxobutyl]-2-phenylphenyl]-[4-[hexyl(methyl)amino]cyclohexyl]carbamic acid (PubChem CID 90239803) has the molecular formula C38H50ClN3O5 and a molecular weight of 664.29 g/mol. Its IUPAC name is [5-[4-[2-chloro-4-(hydroxymethyl)-5-methoxyanilino]-4-oxobutyl]-2-phenylphenyl]-[4-[hexyl(methyl)amino]cyclohexyl]carbamic acid.
| Compound Name | [5-[4-[2-chloro-4-(hydroxymethyl)-5-methoxyanilino]-4-oxobutyl]-2-phenylphenyl]-[4-[hexyl(methyl)amino]cyclohexyl]carbamic acid |
|---|---|
| PubChem CID | 90239803 |
| Molecular Formula | C38H50ClN3O5 |
| Molecular Weight | 664.29 g/mol |
| Exact Mass | 663.34 |
| IUPAC Name | [5-[4-[2-chloro-4-(hydroxymethyl)-5-methoxyanilino]-4-oxobutyl]-2-phenylphenyl]-[4-[hexyl(methyl)amino]cyclohexyl]carbamic acid |
| SMILES | CCCCCCN(C)C1CCC(N(C(=O)O)c2cc(CCCC(=O)Nc3cc(OC)c(CO)cc3Cl)ccc2-c2ccccc2)CC1 |
| InChI | InChI=1S/C38H50ClN3O5/c1-4-5-6-10-22-41(2)30-17-19-31(20-18-30)42(38(45)46)35-23-27(16-21-32(35)28-13-8-7-9-14-28)12-11-15-37(44)40-34-25-36(47-3)29(26-43)24-33(34)39/h7-9,13-14,16,21,23-25,30-31,43H,4-6,10-12,15,17-20,22,26H2,1-3H3,(H,40,44)(H,45,46) |
| InChIKey | GIKFYVANGLEJRV-UHFFFAOYSA-N |
| XLogP | 8.78 |
| TPSA | 102.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.29 |
| LogP ≤ 5 | 8.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|