C42H59ClN4O7Si — CID 90239711
tert-butyl N-[4-[2-[4-[3-[[4-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-chloro-5-methoxyphenyl]carbamoylamino]propyl]-2-carbamoyloxyphenyl]phenyl]cyclohexyl]carbamate (PubChem CID 90239711) has the molecular formula C42H59ClN4O7Si and a molecular weight of 795.49 g/mol. Its IUPAC name is tert-butyl N-[4-[2-[4-[3-[[4-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-chloro-5-methoxyphenyl]carbamoylamino]propyl]-2-carbamoyloxyphenyl]phenyl]cyclohexyl]carbamate.
| Compound Name | tert-butyl N-[4-[2-[4-[3-[[4-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-chloro-5-methoxyphenyl]carbamoylamino]propyl]-2-carbamoyloxyphenyl]phenyl]cyclohexyl]carbamate |
|---|---|
| PubChem CID | 90239711 |
| Molecular Formula | C42H59ClN4O7Si |
| Molecular Weight | 795.49 g/mol |
| Exact Mass | 794.38 |
| IUPAC Name | tert-butyl N-[4-[2-[4-[3-[[4-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-chloro-5-methoxyphenyl]carbamoylamino]propyl]-2-carbamoyloxyphenyl]phenyl]cyclohexyl]carbamate |
| SMILES | COc1cc(NC(=O)NCCCc2ccc(-c3ccccc3C3CCC(NC(=O)OC(C)(C)C)CC3)c(OC(N)=O)c2)c(Cl)cc1CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C42H59ClN4O7Si/c1-41(2,3)54-40(50)46-30-19-17-28(18-20-30)31-14-10-11-15-32(31)33-21-16-27(23-37(33)53-38(44)48)13-12-22-45-39(49)47-35-25-36(51-7)29(24-34(35)43)26-52-55(8,9)42(4,5)6/h10-11,14-16,21,23-25,28,30H,12-13,17-20,22,26H2,1-9H3,(H2,44,48)(H,46,50)(H2,45,47,49) |
| InChIKey | RIHWLKAXWYTWMI-UHFFFAOYSA-N |
| XLogP | 10.30 |
| TPSA | 150.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 795.49 |
| LogP ≤ 5 | 10.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|