C27H33NO4 — CID 157383915
9H-fluoren-9-ylmethyl 2-[4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexyl]acetate (PubChem CID 157383915) has the molecular formula C27H33NO4 and a molecular weight of 435.56 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl 2-[4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexyl]acetate.
| Compound Name | 9H-fluoren-9-ylmethyl 2-[4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexyl]acetate |
|---|---|
| PubChem CID | 157383915 |
| Molecular Formula | C27H33NO4 |
| Molecular Weight | 435.56 g/mol |
| Exact Mass | 435.24 |
| IUPAC Name | 9H-fluoren-9-ylmethyl 2-[4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexyl]acetate |
| SMILES | CC(C)(C)OC(=O)NC1CCC(CC(=O)OCC2c3ccccc3-c3ccccc32)CC1 |
| InChI | InChI=1S/C27H33NO4/c1-27(2,3)32-26(30)28-19-14-12-18(13-15-19)16-25(29)31-17-24-22-10-6-4-8-20(22)21-9-5-7-11-23(21)24/h4-11,18-19,24H,12-17H2,1-3H3,(H,28,30) |
| InChIKey | BLEXVPGALXTESU-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.56 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |