C69H83N5O12 — CID 176842505
tert-butyl N,N-bis[3-[3-(3,4-dimethoxyphenyl)propanoyl-[3-(9H-fluoren-9-ylmethoxycarbonylamino)propyl]amino]propyl]carbamate (PubChem CID 176842505) has the molecular formula C69H83N5O12 and a molecular weight of 1174.45 g/mol. Its IUPAC name is tert-butyl N,N-bis[3-[3-(3,4-dimethoxyphenyl)propanoyl-[3-(9H-fluoren-9-ylmethoxycarbonylamino)propyl]amino]propyl]carbamate.
| Compound Name | tert-butyl N,N-bis[3-[3-(3,4-dimethoxyphenyl)propanoyl-[3-(9H-fluoren-9-ylmethoxycarbonylamino)propyl]amino]propyl]carbamate |
|---|---|
| PubChem CID | 176842505 |
| Molecular Formula | C69H83N5O12 |
| Molecular Weight | 1174.45 g/mol |
| Exact Mass | 1173.60 |
| IUPAC Name | tert-butyl N,N-bis[3-[3-(3,4-dimethoxyphenyl)propanoyl-[3-(9H-fluoren-9-ylmethoxycarbonylamino)propyl]amino]propyl]carbamate |
| SMILES | COc1ccc(CCC(=O)N(CCCNC(=O)OCC2c3ccccc3-c3ccccc32)CCCN(CCCN(CCCNC(=O)OCC2c3ccccc3-c3ccccc32)C(=O)CCc2ccc(OC)c(OC)c2)C(=O)OC(C)(C)C)cc1OC |
| InChI | InChI=1S/C69H83N5O12/c1-69(2,3)86-68(79)74(42-18-40-72(64(75)34-30-48-28-32-60(80-4)62(44-48)82-6)38-16-36-70-66(77)84-46-58-54-24-12-8-20-50(54)51-21-9-13-25-55(51)58)43-19-41-73(65(76)35-31-49-29-33-61(81-5)63(45-49)83-7)39-17-37-71-67(78)85-47-59-56-26-14-10-22-52(56)53-23-11-15-27-57(53)59/h8-15,20-29,32-33,44-45,58-59H,16-19,30-31,34-43,46-47H2,1-7H3,(H,70,77)(H,71,78) |
| InChIKey | PHPWBHICRNDFGO-UHFFFAOYSA-N |
| XLogP | 11.82 |
| TPSA | 183.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 86 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1174.45 |
| LogP ≤ 5 | 11.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|