C45H71N5O12 — CID 176842506
tert-butyl N,N-bis[3-[3-(3,4-dimethoxyphenyl)propanoyl-[3-(ethoxycarbonylamino)propyl]amino]propyl]carbamate (PubChem CID 176842506) has the molecular formula C45H71N5O12 and a molecular weight of 874.09 g/mol. Its IUPAC name is tert-butyl N,N-bis[3-[3-(3,4-dimethoxyphenyl)propanoyl-[3-(ethoxycarbonylamino)propyl]amino]propyl]carbamate.
| Compound Name | tert-butyl N,N-bis[3-[3-(3,4-dimethoxyphenyl)propanoyl-[3-(ethoxycarbonylamino)propyl]amino]propyl]carbamate |
|---|---|
| PubChem CID | 176842506 |
| Molecular Formula | C45H71N5O12 |
| Molecular Weight | 874.09 g/mol |
| Exact Mass | 873.51 |
| IUPAC Name | tert-butyl N,N-bis[3-[3-(3,4-dimethoxyphenyl)propanoyl-[3-(ethoxycarbonylamino)propyl]amino]propyl]carbamate |
| SMILES | CCOC(=O)NCCCN(CCCN(CCCN(CCCNC(=O)OCC)C(=O)CCc1ccc(OC)c(OC)c1)C(=O)OC(C)(C)C)C(=O)CCc1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C45H71N5O12/c1-10-60-42(53)46-24-12-26-48(40(51)22-18-34-16-20-36(56-6)38(32-34)58-8)28-14-30-50(44(55)62-45(3,4)5)31-15-29-49(27-13-25-47-43(54)61-11-2)41(52)23-19-35-17-21-37(57-7)39(33-35)59-9/h16-17,20-21,32-33H,10-15,18-19,22-31H2,1-9H3,(H,46,53)(H,47,54) |
| InChIKey | LUOVRWCTHKITCV-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 183.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 62 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 874.09 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|