C41H45N3O6 — CID 178066859
9H-fluoren-9-yl N-[3-(9H-fluoren-9-ylmethoxycarbonylamino)propyl]-N-[3-[(2-methylpropan-2-yl)oxycarbonylamino]butyl]carbamate (PubChem CID 178066859) has the molecular formula C41H45N3O6 and a molecular weight of 675.83 g/mol. Its IUPAC name is 9H-fluoren-9-yl N-[3-(9H-fluoren-9-ylmethoxycarbonylamino)propyl]-N-[3-[(2-methylpropan-2-yl)oxycarbonylamino]butyl]carbamate.
| Compound Name | 9H-fluoren-9-yl N-[3-(9H-fluoren-9-ylmethoxycarbonylamino)propyl]-N-[3-[(2-methylpropan-2-yl)oxycarbonylamino]butyl]carbamate |
|---|---|
| PubChem CID | 178066859 |
| Molecular Formula | C41H45N3O6 |
| Molecular Weight | 675.83 g/mol |
| Exact Mass | 675.33 |
| IUPAC Name | 9H-fluoren-9-yl N-[3-(9H-fluoren-9-ylmethoxycarbonylamino)propyl]-N-[3-[(2-methylpropan-2-yl)oxycarbonylamino]butyl]carbamate |
| SMILES | CC(CCN(CCCNC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)OC1c2ccccc2-c2ccccc21)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C41H45N3O6/c1-27(43-39(46)50-41(2,3)4)22-25-44(40(47)49-37-34-20-11-9-16-30(34)31-17-10-12-21-35(31)37)24-13-23-42-38(45)48-26-36-32-18-7-5-14-28(32)29-15-6-8-19-33(29)36/h5-12,14-21,27,36-37H,13,22-26H2,1-4H3,(H,42,45)(H,43,46) |
| InChIKey | VDMZXVKELOHCPO-UHFFFAOYSA-N |
| XLogP | 8.43 |
| TPSA | 106.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.83 |
| LogP ≤ 5 | 8.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|