C30H25NO4 — CID 154810049
3-[3-(9H-fluoren-9-ylmethoxycarbonylamino)-4-phenylphenyl]propanoic acid (PubChem CID 154810049) has the molecular formula C30H25NO4 and a molecular weight of 463.53 g/mol. Its IUPAC name is 3-[3-(9H-fluoren-9-ylmethoxycarbonylamino)-4-phenylphenyl]propanoic acid.
| Compound Name | 3-[3-(9H-fluoren-9-ylmethoxycarbonylamino)-4-phenylphenyl]propanoic acid |
|---|---|
| PubChem CID | 154810049 |
| Molecular Formula | C30H25NO4 |
| Molecular Weight | 463.53 g/mol |
| Exact Mass | 463.18 |
| IUPAC Name | 3-[3-(9H-fluoren-9-ylmethoxycarbonylamino)-4-phenylphenyl]propanoic acid |
| SMILES | O=C(O)CCc1ccc(-c2ccccc2)c(NC(=O)OCC2c3ccccc3-c3ccccc32)c1 |
| InChI | InChI=1S/C30H25NO4/c32-29(33)17-15-20-14-16-22(21-8-2-1-3-9-21)28(18-20)31-30(34)35-19-27-25-12-6-4-10-23(25)24-11-5-7-13-26(24)27/h1-14,16,18,27H,15,17,19H2,(H,31,34)(H,32,33) |
| InChIKey | HESWDMKQSYHGBP-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.53 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |