C23H25BrFNO2 — CID 11960596
(8,8-dimethyl-8-azoniabicyclo[3.2.1]oct-6-en-3-yl) 2-fluoro-2,2-diphenylacetate bromide (PubChem CID 11960596) has the molecular formula C23H25BrFNO2 and a molecular weight of 446.36 g/mol. Its IUPAC name is (8,8-dimethyl-8-azoniabicyclo[3.2.1]oct-6-en-3-yl) 2-fluoro-2,2-diphenylacetate bromide.
| Compound Name | (8,8-dimethyl-8-azoniabicyclo[3.2.1]oct-6-en-3-yl) 2-fluoro-2,2-diphenylacetate bromide |
|---|---|
| PubChem CID | 11960596 |
| Molecular Formula | C23H25BrFNO2 |
| Molecular Weight | 446.36 g/mol |
| Exact Mass | 445.11 |
| IUPAC Name | (8,8-dimethyl-8-azoniabicyclo[3.2.1]oct-6-en-3-yl) 2-fluoro-2,2-diphenylacetate bromide |
| SMILES | C[N+]1(C)C2C=CC1CC(OC(=O)C(F)(c1ccccc1)c1ccccc1)C2.[Br-] |
| InChI | InChI=1S/C23H25FNO2.BrH/c1-25(2)19-13-14-20(25)16-21(15-19)27-22(26)23(24,17-9-5-3-6-10-17)18-11-7-4-8-12-18;/h3-14,19-21H,15-16H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | SQNWPPIDMCBPTH-UHFFFAOYSA-M |
| XLogP | 0.99 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.36 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|