C23H21BrF5NO2 — CID 160858369
[(5S)-8,8-dimethyl-8-azoniabicyclo[3.2.1]oct-6-en-3-yl] 2,2-bis(3,4-difluorophenyl)-2-fluoroacetate bromide (PubChem CID 160858369) has the molecular formula C23H21BrF5NO2 and a molecular weight of 518.32 g/mol. Its IUPAC name is [(5S)-8,8-dimethyl-8-azoniabicyclo[3.2.1]oct-6-en-3-yl] 2,2-bis(3,4-difluorophenyl)-2-fluoroacetate bromide.
| Compound Name | [(5S)-8,8-dimethyl-8-azoniabicyclo[3.2.1]oct-6-en-3-yl] 2,2-bis(3,4-difluorophenyl)-2-fluoroacetate bromide |
|---|---|
| PubChem CID | 160858369 |
| Molecular Formula | C23H21BrF5NO2 |
| Molecular Weight | 518.32 g/mol |
| Exact Mass | 517.07 |
| IUPAC Name | [(5S)-8,8-dimethyl-8-azoniabicyclo[3.2.1]oct-6-en-3-yl] 2,2-bis(3,4-difluorophenyl)-2-fluoroacetate bromide |
| SMILES | C[N+]1(C)C2C=C[C@@H]1CC(OC(=O)C(F)(c1ccc(F)c(F)c1)c1ccc(F)c(F)c1)C2.[Br-] |
| InChI | InChI=1S/C23H21F5NO2.BrH/c1-29(2)15-5-6-16(29)12-17(11-15)31-22(30)23(28,13-3-7-18(24)20(26)9-13)14-4-8-19(25)21(27)10-14;/h3-10,15-17H,11-12H2,1-2H3;1H/q+1;/p-1/t15-,16?,17?;/m1./s1 |
| InChIKey | UBJHZNTXLABNTO-WNDXPBGESA-M |
| XLogP | 1.55 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.32 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|