pyrrolidin-3-yl 3,4-dihydro-2H-quinoline-1-carboxylate

C14H18N2O2 — CID 142775986

IUPACpyrrolidin-3-yl 3,4-dihydro-2H-quinoline-1-carboxylate
SMILESO=C(OC1CCNC1)N1CCCc2ccccc21
InChIInChI=1S/C14H18N2O2/c17-14(18-12-7-8-15-10-12)16-9-3-5-11-4-1-2-6-13(11)16/h1-2,4,6,12,15H,3,5,7-10H2
InChIKeyMMRYYMDGJVPJBR-UHFFFAOYSA-N
MW246.31 g/mol
LogP1.94
Rot. Bonds1

About pyrrolidin-3-yl 3,4-dihydro-2H-quinoline-1-carboxylate

pyrrolidin-3-yl 3,4-dihydro-2H-quinoline-1-carboxylate (PubChem CID 142775986) has the molecular formula C14H18N2O2 and a molecular weight of 246.31 g/mol. Its IUPAC name is pyrrolidin-3-yl 3,4-dihydro-2H-quinoline-1-carboxylate.

Molecular Properties

Compound Namepyrrolidin-3-yl 3,4-dihydro-2H-quinoline-1-carboxylate
PubChem CID142775986
Molecular FormulaC14H18N2O2
Molecular Weight246.31 g/mol
Exact Mass246.14
IUPAC Namepyrrolidin-3-yl 3,4-dihydro-2H-quinoline-1-carboxylate
SMILESO=C(OC1CCNC1)N1CCCc2ccccc21
InChIInChI=1S/C14H18N2O2/c17-14(18-12-7-8-15-10-12)16-9-3-5-11-4-1-2-6-13(11)16/h1-2,4,6,12,15H,3,5,7-10H2
InChIKeyMMRYYMDGJVPJBR-UHFFFAOYSA-N
XLogP1.94
TPSA41.57 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500246.31
LogP ≤ 51.94
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze pyrrolidin-3-yl 3,4-dihydro-2H-quinoline-1-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of pyrrolidin-3-yl 3,4-dihydro-2H-quinoline-1-carboxylate?
The IUPAC name of pyrrolidin-3-yl 3,4-dihydro-2H-quinoline-1-carboxylate (CID 142775986) is pyrrolidin-3-yl 3,4-dihydro-2H-quinoline-1-carboxylate.
What is the SMILES notation for pyrrolidin-3-yl 3,4-dihydro-2H-quinoline-1-carboxylate?
The canonical SMILES for pyrrolidin-3-yl 3,4-dihydro-2H-quinoline-1-carboxylate is O=C(OC1CCNC1)N1CCCc2ccccc21.
What is the InChIKey of pyrrolidin-3-yl 3,4-dihydro-2H-quinoline-1-carboxylate?
The InChIKey is MMRYYMDGJVPJBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18N2O2/c17-14(18-12-7-8-15-10-12)16-9-3-5-11-4-1-2-6-13(11)16/h1-2,4,6,12,15H,3,5,7-10H2.
What are the key properties of pyrrolidin-3-yl 3,4-dihydro-2H-quinoline-1-carboxylate?
pyrrolidin-3-yl 3,4-dihydro-2H-quinoline-1-carboxylate has a molecular weight of 246.31 g/mol, XLogP of 1.94, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for pyrrolidin-3-yl 3,4-dihydro-2H-quinoline-1-carboxylate is sourced from PubChem (CID 142775986), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).