About 2-(dimethylamino)ethyl 3,4-dihydro-2H-quinoline-1-carboxylate
2-(dimethylamino)ethyl 3,4-dihydro-2H-quinoline-1-carboxylate (PubChem CID 165352292) has the molecular formula C14H20N2O2
and a molecular weight of 248.33 g/mol. Its IUPAC name is 2-(dimethylamino)ethyl 3,4-dihydro-2H-quinoline-1-carboxylate.
Analyze 2-(dimethylamino)ethyl 3,4-dihydro-2H-quinoline-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(dimethylamino)ethyl 3,4-dihydro-2H-quinoline-1-carboxylate?
The IUPAC name of 2-(dimethylamino)ethyl 3,4-dihydro-2H-quinoline-1-carboxylate (CID 165352292) is 2-(dimethylamino)ethyl 3,4-dihydro-2H-quinoline-1-carboxylate.
What is the SMILES notation for 2-(dimethylamino)ethyl 3,4-dihydro-2H-quinoline-1-carboxylate?
The canonical SMILES for 2-(dimethylamino)ethyl 3,4-dihydro-2H-quinoline-1-carboxylate is CN(C)CCOC(=O)N1CCCc2ccccc21.
What is the InChIKey of 2-(dimethylamino)ethyl 3,4-dihydro-2H-quinoline-1-carboxylate?
The InChIKey is ZCDVOULOPBBIMR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20N2O2/c1-15(2)10-11-18-14(17)16-9-5-7-12-6-3-4-8-13(12)16/h3-4,6,8H,5,7,9-11H2,1-2H3.
What are the key properties of 2-(dimethylamino)ethyl 3,4-dihydro-2H-quinoline-1-carboxylate?
2-(dimethylamino)ethyl 3,4-dihydro-2H-quinoline-1-carboxylate has a molecular weight of 248.33 g/mol, XLogP of 2.14, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(dimethylamino)ethyl 3,4-dihydro-2H-quinoline-1-carboxylate is sourced from PubChem (CID 165352292), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).