C8H11Cl4NO4 — CID 126969412
methyl (2S,4R)-4-(2,2,2-trichloroacetyl)oxypyrrolidine-2-carboxylate;hydrochloride (PubChem CID 126969412) has the molecular formula C8H11Cl4NO4 and a molecular weight of 326.99 g/mol. Its IUPAC name is methyl (2S,4R)-4-(2,2,2-trichloroacetyl)oxypyrrolidine-2-carboxylate;hydrochloride.
| Compound Name | methyl (2S,4R)-4-(2,2,2-trichloroacetyl)oxypyrrolidine-2-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 126969412 |
| Molecular Formula | C8H11Cl4NO4 |
| Molecular Weight | 326.99 g/mol |
| Exact Mass | 324.94 |
| IUPAC Name | methyl (2S,4R)-4-(2,2,2-trichloroacetyl)oxypyrrolidine-2-carboxylate;hydrochloride |
| SMILES | COC(=O)[C@@H]1C[C@@H](OC(=O)C(Cl)(Cl)Cl)CN1.Cl |
| InChI | InChI=1S/C8H10Cl3NO4.ClH/c1-15-6(13)5-2-4(3-12-5)16-7(14)8(9,10)11;/h4-5,12H,2-3H2,1H3;1H/t4-,5+;/m1./s1 |
| InChIKey | CAKJXBYPNRBTIU-JBUOLDKXSA-N |
| XLogP | 1.23 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.99 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|