C18H28O12 — CID 66984791
tetrakis(2-hydroxyethyl) cyclohexane-1,2,4,5-tetracarboxylate (PubChem CID 66984791) has the molecular formula C18H28O12 and a molecular weight of 436.41 g/mol. Its IUPAC name is tetrakis(2-hydroxyethyl) cyclohexane-1,2,4,5-tetracarboxylate.
| Compound Name | tetrakis(2-hydroxyethyl) cyclohexane-1,2,4,5-tetracarboxylate |
|---|---|
| PubChem CID | 66984791 |
| Molecular Formula | C18H28O12 |
| Molecular Weight | 436.41 g/mol |
| Exact Mass | 436.16 |
| IUPAC Name | tetrakis(2-hydroxyethyl) cyclohexane-1,2,4,5-tetracarboxylate |
| SMILES | O=C(OCCO)C1CC(C(=O)OCCO)C(C(=O)OCCO)CC1C(=O)OCCO |
| InChI | InChI=1S/C18H28O12/c19-1-5-27-15(23)11-9-13(17(25)29-7-3-21)14(18(26)30-8-4-22)10-12(11)16(24)28-6-2-20/h11-14,19-22H,1-10H2 |
| InChIKey | XGIXHJQQZKQOTO-UHFFFAOYSA-N |
| XLogP | -2.61 |
| TPSA | 186.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.41 |
| LogP ≤ 5 | -2.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|