C16H28O2 — CID 129175526
tert-butyl 5-tert-butylbicyclo[2.2.1]heptane-2-carboxylate (PubChem CID 129175526) has the molecular formula C16H28O2 and a molecular weight of 252.40 g/mol. Its IUPAC name is tert-butyl 5-tert-butylbicyclo[2.2.1]heptane-2-carboxylate.
| Compound Name | tert-butyl 5-tert-butylbicyclo[2.2.1]heptane-2-carboxylate |
|---|---|
| PubChem CID | 129175526 |
| Molecular Formula | C16H28O2 |
| Molecular Weight | 252.40 g/mol |
| Exact Mass | 252.21 |
| IUPAC Name | tert-butyl 5-tert-butylbicyclo[2.2.1]heptane-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)C1CC2CC1CC2C(C)(C)C |
| InChI | InChI=1S/C16H28O2/c1-15(2,3)13-9-10-7-11(13)8-12(10)14(17)18-16(4,5)6/h10-13H,7-9H2,1-6H3 |
| InChIKey | MJPANUXXCSWMGS-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.40 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |