C10H17NO2 — CID 91040516
tert-butyl (5R)-3-azabicyclo[3.1.0]hexane-6-carboxylate (PubChem CID 91040516) has the molecular formula C10H17NO2 and a molecular weight of 183.25 g/mol. Its IUPAC name is tert-butyl (5R)-3-azabicyclo[3.1.0]hexane-6-carboxylate.
| Compound Name | tert-butyl (5R)-3-azabicyclo[3.1.0]hexane-6-carboxylate |
|---|---|
| PubChem CID | 91040516 |
| Molecular Formula | C10H17NO2 |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.13 |
| IUPAC Name | tert-butyl (5R)-3-azabicyclo[3.1.0]hexane-6-carboxylate |
| SMILES | CC(C)(C)OC(=O)C1C2CNC[C@H]21 |
| InChI | InChI=1S/C10H17NO2/c1-10(2,3)13-9(12)8-6-4-11-5-7(6)8/h6-8,11H,4-5H2,1-3H3/t6-,7?,8?/m1/s1 |
| InChIKey | LDRMTHBWKUYPBH-JECWYVHBSA-N |
| XLogP | 0.79 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |