C12H21ClO2 — CID 6708790
trans-tert-butyl (1R,2R)-4-chloro-2-methylcyclohexane-1-carboxylate (PubChem CID 6708790) has the molecular formula C12H21ClO2 and a molecular weight of 232.75 g/mol. Its IUPAC name is trans-tert-butyl (1R,2R)-4-chloro-2-methylcyclohexane-1-carboxylate.
| Compound Name | trans-tert-butyl (1R,2R)-4-chloro-2-methylcyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 6708790 |
| Molecular Formula | C12H21ClO2 |
| Molecular Weight | 232.75 g/mol |
| Exact Mass | 232.12 |
| IUPAC Name | trans-tert-butyl (1R,2R)-4-chloro-2-methylcyclohexane-1-carboxylate |
| SMILES | C[C@@H]1CC(Cl)CC[C@H]1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C12H21ClO2/c1-8-7-9(13)5-6-10(8)11(14)15-12(2,3)4/h8-10H,5-7H2,1-4H3/t8-,9?,10-/m1/s1 |
| InChIKey | APMORJJNVZMVQK-RCAUJQPQSA-N |
| XLogP | 3.37 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.75 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|