C14H20N2O3 — CID 69285741
[(3R,4S)-4-amino-3-(phenoxymethyl)cyclohexyl]carbamic acid (PubChem CID 69285741) has the molecular formula C14H20N2O3 and a molecular weight of 264.32 g/mol. Its IUPAC name is [(3R,4S)-4-amino-3-(phenoxymethyl)cyclohexyl]carbamic acid.
| Compound Name | [(3R,4S)-4-amino-3-(phenoxymethyl)cyclohexyl]carbamic acid |
|---|---|
| PubChem CID | 69285741 |
| Molecular Formula | C14H20N2O3 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | [(3R,4S)-4-amino-3-(phenoxymethyl)cyclohexyl]carbamic acid |
| SMILES | N[C@H]1CCC(NC(=O)O)C[C@H]1COc1ccccc1 |
| InChI | InChI=1S/C14H20N2O3/c15-13-7-6-11(16-14(17)18)8-10(13)9-19-12-4-2-1-3-5-12/h1-5,10-11,13,16H,6-9,15H2,(H,17,18)/t10-,11?,13-/m0/s1 |
| InChIKey | XENMXOMELPZDKD-BJEKPXQXSA-N |
| XLogP | 1.83 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |