C12H21N3O4 — CID 18943669
methyl 3-[4-(formamidocarbamoylamino)cyclohexyl]propanoate (PubChem CID 18943669) has the molecular formula C12H21N3O4 and a molecular weight of 271.32 g/mol. Its IUPAC name is methyl 3-[4-(formamidocarbamoylamino)cyclohexyl]propanoate.
| Compound Name | methyl 3-[4-(formamidocarbamoylamino)cyclohexyl]propanoate |
|---|---|
| PubChem CID | 18943669 |
| Molecular Formula | C12H21N3O4 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.15 |
| IUPAC Name | methyl 3-[4-(formamidocarbamoylamino)cyclohexyl]propanoate |
| SMILES | COC(=O)CCC1CCC(NC(=O)NNC=O)CC1 |
| InChI | InChI=1S/C12H21N3O4/c1-19-11(17)7-4-9-2-5-10(6-3-9)14-12(18)15-13-8-16/h8-10H,2-7H2,1H3,(H,13,16)(H2,14,15,18) |
| InChIKey | IJKYDNQACZEHLH-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|