C16H31NO4 — CID 15816910
methyl 3-[4-(2,2-diethoxyethylamino)cyclohexyl]propanoate (PubChem CID 15816910) has the molecular formula C16H31NO4 and a molecular weight of 301.43 g/mol. Its IUPAC name is methyl 3-[4-(2,2-diethoxyethylamino)cyclohexyl]propanoate.
| Compound Name | methyl 3-[4-(2,2-diethoxyethylamino)cyclohexyl]propanoate |
|---|---|
| PubChem CID | 15816910 |
| Molecular Formula | C16H31NO4 |
| Molecular Weight | 301.43 g/mol |
| Exact Mass | 301.23 |
| IUPAC Name | methyl 3-[4-(2,2-diethoxyethylamino)cyclohexyl]propanoate |
| SMILES | CCOC(CNC1CCC(CCC(=O)OC)CC1)OCC |
| InChI | InChI=1S/C16H31NO4/c1-4-20-16(21-5-2)12-17-14-9-6-13(7-10-14)8-11-15(18)19-3/h13-14,16-17H,4-12H2,1-3H3 |
| InChIKey | ATNAXRIXCPRFEI-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.43 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|