About N-(2,2-diethoxyethyl)-4-methoxycyclohexan-1-amine
N-(2,2-diethoxyethyl)-4-methoxycyclohexan-1-amine (PubChem CID 113414407) has the molecular formula C13H27NO3
and a molecular weight of 245.36 g/mol. Its IUPAC name is N-(2,2-diethoxyethyl)-4-methoxycyclohexan-1-amine.
Molecular Properties
| Compound Name | N-(2,2-diethoxyethyl)-4-methoxycyclohexan-1-amine |
| PubChem CID | 113414407 |
| Molecular Formula | C13H27NO3 |
| Molecular Weight | 245.36 g/mol |
| Exact Mass | 245.20 |
| IUPAC Name | N-(2,2-diethoxyethyl)-4-methoxycyclohexan-1-amine |
| SMILES | CCOC(CNC1CCC(OC)CC1)OCC |
| InChI | InChI=1S/C13H27NO3/c1-4-16-13(17-5-2)10-14-11-6-8-12(15-3)9-7-11/h11-14H,4-10H2,1-3H3 |
| InChIKey | VFAVNJLGRWKFKW-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.36 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze N-(2,2-diethoxyethyl)-4-methoxycyclohexan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2,2-diethoxyethyl)-4-methoxycyclohexan-1-amine?
The IUPAC name of N-(2,2-diethoxyethyl)-4-methoxycyclohexan-1-amine (CID 113414407) is N-(2,2-diethoxyethyl)-4-methoxycyclohexan-1-amine.
What is the SMILES notation for N-(2,2-diethoxyethyl)-4-methoxycyclohexan-1-amine?
The canonical SMILES for N-(2,2-diethoxyethyl)-4-methoxycyclohexan-1-amine is CCOC(CNC1CCC(OC)CC1)OCC.
What is the InChIKey of N-(2,2-diethoxyethyl)-4-methoxycyclohexan-1-amine?
The InChIKey is VFAVNJLGRWKFKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H27NO3/c1-4-16-13(17-5-2)10-14-11-6-8-12(15-3)9-7-11/h11-14H,4-10H2,1-3H3.
What are the key properties of N-(2,2-diethoxyethyl)-4-methoxycyclohexan-1-amine?
N-(2,2-diethoxyethyl)-4-methoxycyclohexan-1-amine has a molecular weight of 245.36 g/mol, XLogP of 1.93, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,2-diethoxyethyl)-4-methoxycyclohexan-1-amine is sourced from PubChem (CID 113414407), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).