C12H25NO3 — CID 104530610
N-(2,3-dimethoxypropyl)-4-methoxycyclohexan-1-amine (PubChem CID 104530610) has the molecular formula C12H25NO3 and a molecular weight of 231.34 g/mol. Its IUPAC name is N-(2,3-dimethoxypropyl)-4-methoxycyclohexan-1-amine.
| Compound Name | N-(2,3-dimethoxypropyl)-4-methoxycyclohexan-1-amine |
|---|---|
| PubChem CID | 104530610 |
| Molecular Formula | C12H25NO3 |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.18 |
| IUPAC Name | N-(2,3-dimethoxypropyl)-4-methoxycyclohexan-1-amine |
| SMILES | COCC(CNC1CCC(OC)CC1)OC |
| InChI | InChI=1S/C12H25NO3/c1-14-9-12(16-3)8-13-10-4-6-11(15-2)7-5-10/h10-13H,4-9H2,1-3H3 |
| InChIKey | RXRBLZZWLUJSFW-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |