About ethyl 4-[bis(2-hydroxy-3,5-dimethylphenyl)methyl]cyclohexane-1-carboxylate
ethyl 4-[bis(2-hydroxy-3,5-dimethylphenyl)methyl]cyclohexane-1-carboxylate (PubChem CID 58803711) has the molecular formula C26H34O4
and a molecular weight of 410.55 g/mol. Its IUPAC name is ethyl 4-[bis(2-hydroxy-3,5-dimethylphenyl)methyl]cyclohexane-1-carboxylate.
Molecular Properties
| Compound Name | ethyl 4-[bis(2-hydroxy-3,5-dimethylphenyl)methyl]cyclohexane-1-carboxylate |
| PubChem CID | 58803711 |
| Molecular Formula | C26H34O4 |
| Molecular Weight | 410.55 g/mol |
| Exact Mass | 410.25 |
| IUPAC Name | ethyl 4-[bis(2-hydroxy-3,5-dimethylphenyl)methyl]cyclohexane-1-carboxylate |
| SMILES | CCOC(=O)C1CCC(C(c2cc(C)cc(C)c2O)c2cc(C)cc(C)c2O)CC1 |
| InChI | InChI=1S/C26H34O4/c1-6-30-26(29)20-9-7-19(8-10-20)23(21-13-15(2)11-17(4)24(21)27)22-14-16(3)12-18(5)25(22)28/h11-14,19-20,23,27-28H,6-10H2,1-5H3 |
| InChIKey | ZZDNWUMDJLKCIA-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 410.55 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl 4-[bis(2-hydroxy-3,5-dimethylphenyl)methyl]cyclohexane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-[bis(2-hydroxy-3,5-dimethylphenyl)methyl]cyclohexane-1-carboxylate?
The IUPAC name of ethyl 4-[bis(2-hydroxy-3,5-dimethylphenyl)methyl]cyclohexane-1-carboxylate (CID 58803711) is ethyl 4-[bis(2-hydroxy-3,5-dimethylphenyl)methyl]cyclohexane-1-carboxylate.
What is the SMILES notation for ethyl 4-[bis(2-hydroxy-3,5-dimethylphenyl)methyl]cyclohexane-1-carboxylate?
The canonical SMILES for ethyl 4-[bis(2-hydroxy-3,5-dimethylphenyl)methyl]cyclohexane-1-carboxylate is CCOC(=O)C1CCC(C(c2cc(C)cc(C)c2O)c2cc(C)cc(C)c2O)CC1.
What is the InChIKey of ethyl 4-[bis(2-hydroxy-3,5-dimethylphenyl)methyl]cyclohexane-1-carboxylate?
The InChIKey is ZZDNWUMDJLKCIA-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H34O4/c1-6-30-26(29)20-9-7-19(8-10-20)23(21-13-15(2)11-17(4)24(21)27)22-14-16(3)12-18(5)25(22)28/h11-14,19-20,23,27-28H,6-10H2,1-5H3.
What are the key properties of ethyl 4-[bis(2-hydroxy-3,5-dimethylphenyl)methyl]cyclohexane-1-carboxylate?
ethyl 4-[bis(2-hydroxy-3,5-dimethylphenyl)methyl]cyclohexane-1-carboxylate has a molecular weight of 410.55 g/mol, XLogP of 5.83, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-[bis(2-hydroxy-3,5-dimethylphenyl)methyl]cyclohexane-1-carboxylate is sourced from PubChem (CID 58803711), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).