C10H13F2N3O2S — CID 162509680
N-[[2-(difluoromethoxy)pyrimidin-5-yl]methylidene]-2-methylpropane-2-sulfinamide (PubChem CID 162509680) has the molecular formula C10H13F2N3O2S and a molecular weight of 277.30 g/mol. Its IUPAC name is N-[[2-(difluoromethoxy)pyrimidin-5-yl]methylidene]-2-methylpropane-2-sulfinamide.
| Compound Name | N-[[2-(difluoromethoxy)pyrimidin-5-yl]methylidene]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 162509680 |
| Molecular Formula | C10H13F2N3O2S |
| Molecular Weight | 277.30 g/mol |
| Exact Mass | 277.07 |
| IUPAC Name | N-[[2-(difluoromethoxy)pyrimidin-5-yl]methylidene]-2-methylpropane-2-sulfinamide |
| SMILES | CC(C)(C)S(=O)N=Cc1cnc(OC(F)F)nc1 |
| InChI | InChI=1S/C10H13F2N3O2S/c1-10(2,3)18(16)15-6-7-4-13-9(14-5-7)17-8(11)12/h4-6,8H,1-3H3 |
| InChIKey | FPRYNSBZLXERNK-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 64.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.30 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|