C29H46O3Si2 — CID 11179531
(3R,4R)-6-[tert-butyl(diphenyl)silyl]oxy-3-methyl-4-triethylsilyloxyhexanal (PubChem CID 11179531) has the molecular formula C29H46O3Si2 and a molecular weight of 498.86 g/mol. Its IUPAC name is (3R,4R)-6-[tert-butyl(diphenyl)silyl]oxy-3-methyl-4-triethylsilyloxyhexanal.
| Compound Name | (3R,4R)-6-[tert-butyl(diphenyl)silyl]oxy-3-methyl-4-triethylsilyloxyhexanal |
|---|---|
| PubChem CID | 11179531 |
| Molecular Formula | C29H46O3Si2 |
| Molecular Weight | 498.86 g/mol |
| Exact Mass | 498.30 |
| IUPAC Name | (3R,4R)-6-[tert-butyl(diphenyl)silyl]oxy-3-methyl-4-triethylsilyloxyhexanal |
| SMILES | CC[Si](CC)(CC)O[C@H](CCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)[C@H](C)CC=O |
| InChI | InChI=1S/C29H46O3Si2/c1-8-33(9-2,10-3)32-28(25(4)21-23-30)22-24-31-34(29(5,6)7,26-17-13-11-14-18-26)27-19-15-12-16-20-27/h11-20,23,25,28H,8-10,21-22,24H2,1-7H3/t25-,28-/m1/s1 |
| InChIKey | UKSOEJFMQXVWMN-LEAFIULHSA-N |
| XLogP | 6.57 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.86 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|