C31H35N5OSi — CID 71070653
N'-[3-benzyl-5-[(S)-[tert-butyl(diphenyl)silyl]oxy-cyanomethyl]imidazol-4-yl]-N,N-dimethylmethanimidamide (PubChem CID 71070653) has the molecular formula C31H35N5OSi and a molecular weight of 521.74 g/mol. Its IUPAC name is N'-[3-benzyl-5-[(S)-[tert-butyl(diphenyl)silyl]oxy-cyanomethyl]imidazol-4-yl]-N,N-dimethylmethanimidamide.
| Compound Name | N'-[3-benzyl-5-[(S)-[tert-butyl(diphenyl)silyl]oxy-cyanomethyl]imidazol-4-yl]-N,N-dimethylmethanimidamide |
|---|---|
| PubChem CID | 71070653 |
| Molecular Formula | C31H35N5OSi |
| Molecular Weight | 521.74 g/mol |
| Exact Mass | 521.26 |
| IUPAC Name | N'-[3-benzyl-5-[(S)-[tert-butyl(diphenyl)silyl]oxy-cyanomethyl]imidazol-4-yl]-N,N-dimethylmethanimidamide |
| SMILES | CN(C)C=Nc1c([C@@H](C#N)O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)ncn1Cc1ccccc1 |
| InChI | InChI=1S/C31H35N5OSi/c1-31(2,3)38(26-17-11-7-12-18-26,27-19-13-8-14-20-27)37-28(21-32)29-30(34-23-35(4)5)36(24-33-29)22-25-15-9-6-10-16-25/h6-20,23-24,28H,22H2,1-5H3/t28-/m1/s1 |
| InChIKey | ZUGRSWVIFIBSIC-MUUNZHRXSA-N |
| XLogP | 5.29 |
| TPSA | 66.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.74 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|