C32H24Cl3NO7S — CID 129300089
[(2R,3S,4S)-3,4-dibenzoyloxy-5-imino-2-(2,4,5-trichlorophenyl)sulfanyloxypentyl] benzoate (PubChem CID 129300089) has the molecular formula C32H24Cl3NO7S and a molecular weight of 672.97 g/mol. Its IUPAC name is [(2R,3S,4S)-3,4-dibenzoyloxy-5-imino-2-(2,4,5-trichlorophenyl)sulfanyloxypentyl] benzoate.
| Compound Name | [(2R,3S,4S)-3,4-dibenzoyloxy-5-imino-2-(2,4,5-trichlorophenyl)sulfanyloxypentyl] benzoate |
|---|---|
| PubChem CID | 129300089 |
| Molecular Formula | C32H24Cl3NO7S |
| Molecular Weight | 672.97 g/mol |
| Exact Mass | 671.03 |
| IUPAC Name | [(2R,3S,4S)-3,4-dibenzoyloxy-5-imino-2-(2,4,5-trichlorophenyl)sulfanyloxypentyl] benzoate |
| SMILES | [H]/N=C/[C@H](OC(=O)c1ccccc1)[C@H](OC(=O)c1ccccc1)[C@@H](COC(=O)c1ccccc1)OSc1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C32H24Cl3NO7S/c33-23-16-25(35)28(17-24(23)34)44-43-27(19-40-30(37)20-10-4-1-5-11-20)29(42-32(39)22-14-8-3-9-15-22)26(18-36)41-31(38)21-12-6-2-7-13-21/h1-18,26-27,29,36H,19H2/b36-18+/t26-,27+,29-/m0/s1 |
| InChIKey | XZDWNYUZDLXYNX-PYHGVMDPSA-N |
| XLogP | 8.00 |
| TPSA | 111.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.97 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|