C27H23NO7 — CID 163425164
[(2R)-2-[(1S,2S)-1,2-dibenzoyloxy-3-iminopropyl]-2-hydroxycyclopropyl] benzoate (PubChem CID 163425164) has the molecular formula C27H23NO7 and a molecular weight of 473.48 g/mol. Its IUPAC name is [(2R)-2-[(1S,2S)-1,2-dibenzoyloxy-3-iminopropyl]-2-hydroxycyclopropyl] benzoate.
| Compound Name | [(2R)-2-[(1S,2S)-1,2-dibenzoyloxy-3-iminopropyl]-2-hydroxycyclopropyl] benzoate |
|---|---|
| PubChem CID | 163425164 |
| Molecular Formula | C27H23NO7 |
| Molecular Weight | 473.48 g/mol |
| Exact Mass | 473.15 |
| IUPAC Name | [(2R)-2-[(1S,2S)-1,2-dibenzoyloxy-3-iminopropyl]-2-hydroxycyclopropyl] benzoate |
| SMILES | [H]/N=C/[C@H](OC(=O)c1ccccc1)[C@H](OC(=O)c1ccccc1)[C@@]1(O)CC1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C27H23NO7/c28-17-21(33-24(29)18-10-4-1-5-11-18)23(35-26(31)20-14-8-3-9-15-20)27(32)16-22(27)34-25(30)19-12-6-2-7-13-19/h1-15,17,21-23,28,32H,16H2/b28-17+/t21-,22?,23-,27+/m0/s1 |
| InChIKey | ALWALGGEMGCKFJ-JKJHTWPOSA-N |
| XLogP | 3.45 |
| TPSA | 122.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.48 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|