C11H10F2O3 — CID 152635930
(4,4-difluorooxolan-3-yl) benzoate (PubChem CID 152635930) has the molecular formula C11H10F2O3 and a molecular weight of 228.19 g/mol. Its IUPAC name is (4,4-difluorooxolan-3-yl) benzoate.
| Compound Name | (4,4-difluorooxolan-3-yl) benzoate |
|---|---|
| PubChem CID | 152635930 |
| Molecular Formula | C11H10F2O3 |
| Molecular Weight | 228.19 g/mol |
| Exact Mass | 228.06 |
| IUPAC Name | (4,4-difluorooxolan-3-yl) benzoate |
| SMILES | O=C(OC1COCC1(F)F)c1ccccc1 |
| InChI | InChI=1S/C11H10F2O3/c12-11(13)7-15-6-9(11)16-10(14)8-4-2-1-3-5-8/h1-5,9H,6-7H2 |
| InChIKey | ZENLAYBYRKANRU-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.19 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |