C14H16F2O3 — CID 168761875
[(1R,3S)-4,4-difluoro-3-methoxycyclohexyl] benzoate (PubChem CID 168761875) has the molecular formula C14H16F2O3 and a molecular weight of 270.27 g/mol. Its IUPAC name is [(1R,3S)-4,4-difluoro-3-methoxycyclohexyl] benzoate.
| Compound Name | [(1R,3S)-4,4-difluoro-3-methoxycyclohexyl] benzoate |
|---|---|
| PubChem CID | 168761875 |
| Molecular Formula | C14H16F2O3 |
| Molecular Weight | 270.27 g/mol |
| Exact Mass | 270.11 |
| IUPAC Name | [(1R,3S)-4,4-difluoro-3-methoxycyclohexyl] benzoate |
| SMILES | CO[C@H]1C[C@H](OC(=O)c2ccccc2)CCC1(F)F |
| InChI | InChI=1S/C14H16F2O3/c1-18-12-9-11(7-8-14(12,15)16)19-13(17)10-5-3-2-4-6-10/h2-6,11-12H,7-9H2,1H3/t11-,12+/m1/s1 |
| InChIKey | OSLBXZSDDGABPQ-NEPJUHHUSA-N |
| XLogP | 3.05 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.27 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |