C14H15F2NO2 — CID 176887706
[3-(3,3-difluoroazetidin-1-yl)cyclobutyl] benzoate (PubChem CID 176887706) has the molecular formula C14H15F2NO2 and a molecular weight of 267.27 g/mol. Its IUPAC name is [3-(3,3-difluoroazetidin-1-yl)cyclobutyl] benzoate.
| Compound Name | [3-(3,3-difluoroazetidin-1-yl)cyclobutyl] benzoate |
|---|---|
| PubChem CID | 176887706 |
| Molecular Formula | C14H15F2NO2 |
| Molecular Weight | 267.27 g/mol |
| Exact Mass | 267.11 |
| IUPAC Name | [3-(3,3-difluoroazetidin-1-yl)cyclobutyl] benzoate |
| SMILES | O=C(OC1CC(N2CC(F)(F)C2)C1)c1ccccc1 |
| InChI | InChI=1S/C14H15F2NO2/c15-14(16)8-17(9-14)11-6-12(7-11)19-13(18)10-4-2-1-3-5-10/h1-5,11-12H,6-9H2 |
| InChIKey | RADJXZDNSHYQMC-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.27 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |