C15H19NO2 — CID 15102359
[(1S,3S,5R)-6-methyl-6-azabicyclo[3.2.1]octan-3-yl] benzoate (PubChem CID 15102359) has the molecular formula C15H19NO2 and a molecular weight of 245.32 g/mol. Its IUPAC name is [(1S,3S,5R)-6-methyl-6-azabicyclo[3.2.1]octan-3-yl] benzoate.
| Compound Name | [(1S,3S,5R)-6-methyl-6-azabicyclo[3.2.1]octan-3-yl] benzoate |
|---|---|
| PubChem CID | 15102359 |
| Molecular Formula | C15H19NO2 |
| Molecular Weight | 245.32 g/mol |
| Exact Mass | 245.14 |
| IUPAC Name | [(1S,3S,5R)-6-methyl-6-azabicyclo[3.2.1]octan-3-yl] benzoate |
| SMILES | CN1C[C@@H]2C[C@H](OC(=O)c3ccccc3)C[C@H]1C2 |
| InChI | InChI=1S/C15H19NO2/c1-16-10-11-7-13(16)9-14(8-11)18-15(17)12-5-3-2-4-6-12/h2-6,11,13-14H,7-10H2,1H3/t11-,13+,14-/m0/s1 |
| InChIKey | JJGGJOXCHDPVTJ-YUTCNCBUSA-N |
| XLogP | 2.33 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.32 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |