C15H20BNO3 — CID 58035468
[(1R,5R)-3-benzoyloxy-8-azabicyclo[3.2.1]octan-8-yl]-methylborinic acid (PubChem CID 58035468) has the molecular formula C15H20BNO3 and a molecular weight of 273.14 g/mol. Its IUPAC name is [(1R,5R)-3-benzoyloxy-8-azabicyclo[3.2.1]octan-8-yl]-methylborinic acid.
| Compound Name | [(1R,5R)-3-benzoyloxy-8-azabicyclo[3.2.1]octan-8-yl]-methylborinic acid |
|---|---|
| PubChem CID | 58035468 |
| Molecular Formula | C15H20BNO3 |
| Molecular Weight | 273.14 g/mol |
| Exact Mass | 273.15 |
| IUPAC Name | [(1R,5R)-3-benzoyloxy-8-azabicyclo[3.2.1]octan-8-yl]-methylborinic acid |
| SMILES | CB(O)N1[C@@H]2CC[C@@H]1CC(OC(=O)c1ccccc1)C2 |
| InChI | InChI=1S/C15H20BNO3/c1-16(19)17-12-7-8-13(17)10-14(9-12)20-15(18)11-5-3-2-4-6-11/h2-6,12-14,19H,7-10H2,1H3/t12-,13-/m1/s1 |
| InChIKey | OKCLSTNRSPGVEV-CHWSQXEVSA-N |
| XLogP | 1.95 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.14 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|