C18H22O3 — CID 11312202
[(2S,4aS,7S)-7-hydroxy-4a-methyl-2,3,4,7,8,8a-hexahydro-1H-naphthalen-2-yl] benzoate (PubChem CID 11312202) has the molecular formula C18H22O3 and a molecular weight of 286.37 g/mol. Its IUPAC name is [(2S,4aS,7S)-7-hydroxy-4a-methyl-2,3,4,7,8,8a-hexahydro-1H-naphthalen-2-yl] benzoate.
| Compound Name | [(2S,4aS,7S)-7-hydroxy-4a-methyl-2,3,4,7,8,8a-hexahydro-1H-naphthalen-2-yl] benzoate |
|---|---|
| PubChem CID | 11312202 |
| Molecular Formula | C18H22O3 |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.16 |
| IUPAC Name | [(2S,4aS,7S)-7-hydroxy-4a-methyl-2,3,4,7,8,8a-hexahydro-1H-naphthalen-2-yl] benzoate |
| SMILES | C[C@@]12C=C[C@@H](O)CC1C[C@@H](OC(=O)c1ccccc1)CC2 |
| InChI | InChI=1S/C18H22O3/c1-18-9-7-15(19)11-14(18)12-16(8-10-18)21-17(20)13-5-3-2-4-6-13/h2-7,9,14-16,19H,8,10-12H2,1H3/t14?,15-,16+,18+/m1/s1 |
| InChIKey | IEMIRHNZSHMOTN-GFBFAKRDSA-N |
| XLogP | 3.34 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|