C31H38O4 — CID 3437607
(7-benzoyloxy-4a,4b,8-trimethyl-1,2,3,4,5,6,7,8,8a,9,10,10a-dodecahydrophenanthren-2-yl) benzoate (PubChem CID 3437607) has the molecular formula C31H38O4 and a molecular weight of 474.64 g/mol. Its IUPAC name is (7-benzoyloxy-4a,4b,8-trimethyl-1,2,3,4,5,6,7,8,8a,9,10,10a-dodecahydrophenanthren-2-yl) benzoate.
| Compound Name | (7-benzoyloxy-4a,4b,8-trimethyl-1,2,3,4,5,6,7,8,8a,9,10,10a-dodecahydrophenanthren-2-yl) benzoate |
|---|---|
| PubChem CID | 3437607 |
| Molecular Formula | C31H38O4 |
| Molecular Weight | 474.64 g/mol |
| Exact Mass | 474.28 |
| IUPAC Name | (7-benzoyloxy-4a,4b,8-trimethyl-1,2,3,4,5,6,7,8,8a,9,10,10a-dodecahydrophenanthren-2-yl) benzoate |
| SMILES | CC1C(OC(=O)c2ccccc2)CCC2(C)C1CCC1CC(OC(=O)c3ccccc3)CCC12C |
| InChI | InChI=1S/C31H38O4/c1-21-26-15-14-24-20-25(34-28(32)22-10-6-4-7-11-22)16-18-30(24,2)31(26,3)19-17-27(21)35-29(33)23-12-8-5-9-13-23/h4-13,21,24-27H,14-20H2,1-3H3 |
| InChIKey | KLWFOZGDHXPYQR-UHFFFAOYSA-N |
| XLogP | 7.09 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.64 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |