C26H33BrO3 — CID 90243170
[(3R,5S,10S)-17-carbonobromidoyl-10-methyl-1,2,3,4,5,6,7,8,9,11,12,13,14,15,16,17-hexadecahydrocyclopenta[a]phenanthren-3-yl] benzoate (PubChem CID 90243170) has the molecular formula C26H33BrO3 and a molecular weight of 473.45 g/mol. Its IUPAC name is [(3R,5S,10S)-17-carbonobromidoyl-10-methyl-1,2,3,4,5,6,7,8,9,11,12,13,14,15,16,17-hexadecahydrocyclopenta[a]phenanthren-3-yl] benzoate.
| Compound Name | [(3R,5S,10S)-17-carbonobromidoyl-10-methyl-1,2,3,4,5,6,7,8,9,11,12,13,14,15,16,17-hexadecahydrocyclopenta[a]phenanthren-3-yl] benzoate |
|---|---|
| PubChem CID | 90243170 |
| Molecular Formula | C26H33BrO3 |
| Molecular Weight | 473.45 g/mol |
| Exact Mass | 472.16 |
| IUPAC Name | [(3R,5S,10S)-17-carbonobromidoyl-10-methyl-1,2,3,4,5,6,7,8,9,11,12,13,14,15,16,17-hexadecahydrocyclopenta[a]phenanthren-3-yl] benzoate |
| SMILES | C[C@]12CC[C@@H](OC(=O)c3ccccc3)C[C@@H]1CCC1C3CCC(C(=O)Br)C3CCC12 |
| InChI | InChI=1S/C26H33BrO3/c1-26-14-13-18(30-25(29)16-5-3-2-4-6-16)15-17(26)7-8-21-19-9-10-22(24(27)28)20(19)11-12-23(21)26/h2-6,17-23H,7-15H2,1H3/t17-,18+,19?,20?,21?,22?,23?,26-/m0/s1 |
| InChIKey | UMJAYKNBTKHPKW-QBZNVSTOSA-N |
| XLogP | 6.40 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.45 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|