C35H41BrO5 — CID 4167878
[17-(1-benzoyloxyethyl)-9-bromo-10,13-dimethyl-11-oxo-2,3,4,5,6,7,8,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] benzoate (PubChem CID 4167878) has the molecular formula C35H41BrO5 and a molecular weight of 621.61 g/mol. Its IUPAC name is [17-(1-benzoyloxyethyl)-9-bromo-10,13-dimethyl-11-oxo-2,3,4,5,6,7,8,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] benzoate.
| Compound Name | [17-(1-benzoyloxyethyl)-9-bromo-10,13-dimethyl-11-oxo-2,3,4,5,6,7,8,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] benzoate |
|---|---|
| PubChem CID | 4167878 |
| Molecular Formula | C35H41BrO5 |
| Molecular Weight | 621.61 g/mol |
| Exact Mass | 620.21 |
| IUPAC Name | [17-(1-benzoyloxyethyl)-9-bromo-10,13-dimethyl-11-oxo-2,3,4,5,6,7,8,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] benzoate |
| SMILES | CC(OC(=O)c1ccccc1)C1CCC2C3CCC4CC(OC(=O)c5ccccc5)CCC4(C)C3(Br)C(=O)CC12C |
| InChI | InChI=1S/C35H41BrO5/c1-22(40-31(38)23-10-6-4-7-11-23)27-16-17-28-29-15-14-25-20-26(41-32(39)24-12-8-5-9-13-24)18-19-34(25,3)35(29,36)30(37)21-33(27,28)2/h4-13,22,25-29H,14-21H2,1-3H3 |
| InChIKey | LPWTUDWHHMCLMN-UHFFFAOYSA-N |
| XLogP | 7.81 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.61 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|