C35H40O5 — CID 125032260
[(3R,5S,10S,13S,14S,17R)-17-[(1S)-1-benzoyloxyethyl]-10,13-dimethyl-11-oxo-1,2,3,4,5,6,7,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-yl] benzoate (PubChem CID 125032260) has the molecular formula C35H40O5 and a molecular weight of 540.70 g/mol. Its IUPAC name is [(3R,5S,10S,13S,14S,17R)-17-[(1S)-1-benzoyloxyethyl]-10,13-dimethyl-11-oxo-1,2,3,4,5,6,7,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-yl] benzoate.
| Compound Name | [(3R,5S,10S,13S,14S,17R)-17-[(1S)-1-benzoyloxyethyl]-10,13-dimethyl-11-oxo-1,2,3,4,5,6,7,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-yl] benzoate |
|---|---|
| PubChem CID | 125032260 |
| Molecular Formula | C35H40O5 |
| Molecular Weight | 540.70 g/mol |
| Exact Mass | 540.29 |
| IUPAC Name | [(3R,5S,10S,13S,14S,17R)-17-[(1S)-1-benzoyloxyethyl]-10,13-dimethyl-11-oxo-1,2,3,4,5,6,7,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-yl] benzoate |
| SMILES | C[C@H](OC(=O)c1ccccc1)[C@@H]1CC[C@@H]2C3=C(C(=O)C[C@@]21C)[C@@]1(C)CC[C@@H](OC(=O)c2ccccc2)C[C@@H]1CC3 |
| InChI | InChI=1S/C35H40O5/c1-22(39-32(37)23-10-6-4-7-11-23)28-16-17-29-27-15-14-25-20-26(40-33(38)24-12-8-5-9-13-24)18-19-34(25,2)31(27)30(36)21-35(28,29)3/h4-13,22,25-26,28-29H,14-21H2,1-3H3/t22-,25-,26+,28-,29+,34-,35+/m0/s1 |
| InChIKey | WDFQMBJDBZUZNP-VTCVYGMESA-N |
| XLogP | 7.36 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.70 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |