C34H48O3 — CID 57145395
[(3S,10S,13R,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-11-oxo-1,2,3,4,5,6,7,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-yl] benzoate (PubChem CID 57145395) has the molecular formula C34H48O3 and a molecular weight of 504.76 g/mol. Its IUPAC name is [(3S,10S,13R,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-11-oxo-1,2,3,4,5,6,7,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-yl] benzoate.
| Compound Name | [(3S,10S,13R,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-11-oxo-1,2,3,4,5,6,7,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-yl] benzoate |
|---|---|
| PubChem CID | 57145395 |
| Molecular Formula | C34H48O3 |
| Molecular Weight | 504.76 g/mol |
| Exact Mass | 504.36 |
| IUPAC Name | [(3S,10S,13R,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-11-oxo-1,2,3,4,5,6,7,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-yl] benzoate |
| SMILES | CC(C)CCC[C@@H](C)[C@H]1CCC2C3=C(C(=O)C[C@@]21C)[C@@]1(C)CC[C@H](OC(=O)c2ccccc2)CC1CC3 |
| InChI | InChI=1S/C34H48O3/c1-22(2)10-9-11-23(3)28-16-17-29-27-15-14-25-20-26(37-32(36)24-12-7-6-8-13-24)18-19-33(25,4)31(27)30(35)21-34(28,29)5/h6-8,12-13,22-23,25-26,28-29H,9-11,14-21H2,1-5H3/t23-,25?,26+,28-,29?,33+,34-/m1/s1 |
| InChIKey | UIYDAIYKHDGEFE-PROYJGOXSA-N |
| XLogP | 8.58 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.76 |
| LogP ≤ 5 | 8.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |