C38H54O5 — CID 67924050
[(3S,5S,10S,13R,14R,17R)-14-(2-ethoxy-2-oxoethyl)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-15-oxo-2,3,4,5,6,7,11,12,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl] benzoate (PubChem CID 67924050) has the molecular formula C38H54O5 and a molecular weight of 590.85 g/mol. Its IUPAC name is [(3S,5S,10S,13R,14R,17R)-14-(2-ethoxy-2-oxoethyl)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-15-oxo-2,3,4,5,6,7,11,12,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl] benzoate.
| Compound Name | [(3S,5S,10S,13R,14R,17R)-14-(2-ethoxy-2-oxoethyl)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-15-oxo-2,3,4,5,6,7,11,12,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl] benzoate |
|---|---|
| PubChem CID | 67924050 |
| Molecular Formula | C38H54O5 |
| Molecular Weight | 590.85 g/mol |
| Exact Mass | 590.40 |
| IUPAC Name | [(3S,5S,10S,13R,14R,17R)-14-(2-ethoxy-2-oxoethyl)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-15-oxo-2,3,4,5,6,7,11,12,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl] benzoate |
| SMILES | CCOC(=O)C[C@@]12C(=O)C[C@H]([C@H](C)CCCC(C)C)[C@@]1(C)CCC1=C2CC[C@H]2C[C@@H](OC(=O)c3ccccc3)CC[C@]12C |
| InChI | InChI=1S/C38H54O5/c1-7-42-34(40)24-38-31-17-16-28-22-29(43-35(41)27-14-9-8-10-15-27)18-20-36(28,5)30(31)19-21-37(38,6)32(23-33(38)39)26(4)13-11-12-25(2)3/h8-10,14-15,25-26,28-29,32H,7,11-13,16-24H2,1-6H3/t26-,28+,29+,32-,36+,37-,38-/m1/s1 |
| InChIKey | JICDQHVUBZQDQW-UVOVCYSJSA-N |
| XLogP | 8.90 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.85 |
| LogP ≤ 5 | 8.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|