C33H54O4 — CID 67924101
4-[(3S,5R,10S,13R,14R,17R)-3-hydroxy-4,4,10,13-tetramethyl-17-[(2R)-6-methylheptan-2-yl]-15-oxo-1,2,3,5,6,7,11,12,16,17-decahydrocyclopenta[a]phenanthren-14-yl]butanoic acid (PubChem CID 67924101) has the molecular formula C33H54O4 and a molecular weight of 514.79 g/mol. Its IUPAC name is 4-[(3S,5R,10S,13R,14R,17R)-3-hydroxy-4,4,10,13-tetramethyl-17-[(2R)-6-methylheptan-2-yl]-15-oxo-1,2,3,5,6,7,11,12,16,17-decahydrocyclopenta[a]phenanthren-14-yl]butanoic acid.
| Compound Name | 4-[(3S,5R,10S,13R,14R,17R)-3-hydroxy-4,4,10,13-tetramethyl-17-[(2R)-6-methylheptan-2-yl]-15-oxo-1,2,3,5,6,7,11,12,16,17-decahydrocyclopenta[a]phenanthren-14-yl]butanoic acid |
|---|---|
| PubChem CID | 67924101 |
| Molecular Formula | C33H54O4 |
| Molecular Weight | 514.79 g/mol |
| Exact Mass | 514.40 |
| IUPAC Name | 4-[(3S,5R,10S,13R,14R,17R)-3-hydroxy-4,4,10,13-tetramethyl-17-[(2R)-6-methylheptan-2-yl]-15-oxo-1,2,3,5,6,7,11,12,16,17-decahydrocyclopenta[a]phenanthren-14-yl]butanoic acid |
| SMILES | CC(C)CCC[C@@H](C)[C@H]1CC(=O)[C@@]2(CCCC(=O)O)C3=C(CC[C@]12C)[C@@]1(C)CC[C@H](O)C(C)(C)[C@@H]1CC3 |
| InChI | InChI=1S/C33H54O4/c1-21(2)10-8-11-22(3)25-20-28(35)33(17-9-12-29(36)37)24-13-14-26-30(4,5)27(34)16-18-31(26,6)23(24)15-19-32(25,33)7/h21-22,25-27,34H,8-20H2,1-7H3,(H,36,37)/t22-,25-,26+,27+,31-,32-,33-/m1/s1 |
| InChIKey | MASCEBRDTOYYDO-IQPDTFBKSA-N |
| XLogP | 7.97 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.79 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|