C37H54O3 — CID 10007808
[(3S,5R,10S,13R,14R,17R)-4,4,10,13-tetramethyl-17-[(2R)-6-methylheptan-2-yl]-15-oxo-14-(tritritiomethyl)-1,2,3,5,6,7,11,12,16,17-decahydrocyclopenta[a]phenanthren-3-yl] benzoate (PubChem CID 10007808) has the molecular formula C37H54O3 and a molecular weight of 552.86 g/mol. Its IUPAC name is [(3S,5R,10S,13R,14R,17R)-4,4,10,13-tetramethyl-17-[(2R)-6-methylheptan-2-yl]-15-oxo-14-(tritritiomethyl)-1,2,3,5,6,7,11,12,16,17-decahydrocyclopenta[a]phenanthren-3-yl] benzoate.
| Compound Name | [(3S,5R,10S,13R,14R,17R)-4,4,10,13-tetramethyl-17-[(2R)-6-methylheptan-2-yl]-15-oxo-14-(tritritiomethyl)-1,2,3,5,6,7,11,12,16,17-decahydrocyclopenta[a]phenanthren-3-yl] benzoate |
|---|---|
| PubChem CID | 10007808 |
| Molecular Formula | C37H54O3 |
| Molecular Weight | 552.86 g/mol |
| Exact Mass | 552.43 |
| IUPAC Name | [(3S,5R,10S,13R,14R,17R)-4,4,10,13-tetramethyl-17-[(2R)-6-methylheptan-2-yl]-15-oxo-14-(tritritiomethyl)-1,2,3,5,6,7,11,12,16,17-decahydrocyclopenta[a]phenanthren-3-yl] benzoate |
| SMILES | [3H]C([3H])([3H])[C@@]12C(=O)C[C@H]([C@H](C)CCCC(C)C)[C@@]1(C)CCC1=C2CC[C@H]2C(C)(C)[C@@H](OC(=O)c3ccccc3)CC[C@]12C |
| InChI | InChI=1S/C37H54O3/c1-24(2)13-12-14-25(3)29-23-31(38)37(8)28-17-18-30-34(4,5)32(40-33(39)26-15-10-9-11-16-26)20-21-35(30,6)27(28)19-22-36(29,37)7/h9-11,15-16,24-25,29-30,32H,12-14,17-23H2,1-8H3/t25-,29-,30+,32+,35-,36-,37-/m1/s1/i8T3 |
| InChIKey | ZIQDGCMFQGYYOE-HLIYNNDRSA-N |
| XLogP | 9.60 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.86 |
| LogP ≤ 5 | 9.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|