C38H53F3O2 — CID 139425432
[(3S,10S,13R,14R,17R)-4,4,10,13,14-pentamethyl-17-[(2R)-6-methylhept-5-en-2-yl]-2,3,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl] 4-(trifluoromethyl)benzoate (PubChem CID 139425432) has the molecular formula C38H53F3O2 and a molecular weight of 598.83 g/mol. Its IUPAC name is [(3S,10S,13R,14R,17R)-4,4,10,13,14-pentamethyl-17-[(2R)-6-methylhept-5-en-2-yl]-2,3,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl] 4-(trifluoromethyl)benzoate.
| Compound Name | [(3S,10S,13R,14R,17R)-4,4,10,13,14-pentamethyl-17-[(2R)-6-methylhept-5-en-2-yl]-2,3,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl] 4-(trifluoromethyl)benzoate |
|---|---|
| PubChem CID | 139425432 |
| Molecular Formula | C38H53F3O2 |
| Molecular Weight | 598.83 g/mol |
| Exact Mass | 598.40 |
| IUPAC Name | [(3S,10S,13R,14R,17R)-4,4,10,13,14-pentamethyl-17-[(2R)-6-methylhept-5-en-2-yl]-2,3,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl] 4-(trifluoromethyl)benzoate |
| SMILES | CC(C)=CCC[C@@H](C)[C@H]1CC[C@@]2(C)C3=C(CC[C@]12C)[C@@]1(C)CC[C@H](OC(=O)c2ccc(C(F)(F)F)cc2)C(C)(C)C1CC3 |
| InChI | InChI=1S/C38H53F3O2/c1-24(2)10-9-11-25(3)28-18-22-37(8)30-16-17-31-34(4,5)32(20-21-35(31,6)29(30)19-23-36(28,37)7)43-33(42)26-12-14-27(15-13-26)38(39,40)41/h10,12-15,25,28,31-32H,9,11,16-23H2,1-8H3/t25-,28-,31?,32+,35-,36-,37+/m1/s1 |
| InChIKey | VWBRUBQFMXRMLM-LVYNMYDLSA-N |
| XLogP | 11.36 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.83 |
| LogP ≤ 5 | 11.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|