C35H57NO2 — CID 139425418
[(3S,10S,13R,14R,17R)-4,4,10,13,14-pentamethyl-17-[(2R)-6-methylhept-5-en-2-yl]-2,3,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl] (2S)-pyrrolidine-2-carboxylate (PubChem CID 139425418) has the molecular formula C35H57NO2 and a molecular weight of 523.85 g/mol. Its IUPAC name is [(3S,10S,13R,14R,17R)-4,4,10,13,14-pentamethyl-17-[(2R)-6-methylhept-5-en-2-yl]-2,3,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl] (2S)-pyrrolidine-2-carboxylate.
| Compound Name | [(3S,10S,13R,14R,17R)-4,4,10,13,14-pentamethyl-17-[(2R)-6-methylhept-5-en-2-yl]-2,3,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl] (2S)-pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 139425418 |
| Molecular Formula | C35H57NO2 |
| Molecular Weight | 523.85 g/mol |
| Exact Mass | 523.44 |
| IUPAC Name | [(3S,10S,13R,14R,17R)-4,4,10,13,14-pentamethyl-17-[(2R)-6-methylhept-5-en-2-yl]-2,3,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl] (2S)-pyrrolidine-2-carboxylate |
| SMILES | CC(C)=CCC[C@@H](C)[C@H]1CC[C@@]2(C)C3=C(CC[C@]12C)[C@@]1(C)CC[C@H](OC(=O)[C@@H]2CCCN2)C(C)(C)C1CC3 |
| InChI | InChI=1S/C35H57NO2/c1-23(2)11-9-12-24(3)25-16-20-35(8)27-14-15-29-32(4,5)30(38-31(37)28-13-10-22-36-28)18-19-33(29,6)26(27)17-21-34(25,35)7/h11,24-25,28-30,36H,9-10,12-22H2,1-8H3/t24-,25-,28+,29?,30+,33-,34-,35+/m1/s1 |
| InChIKey | SNGFIJBHRXFYET-GNNQVETBSA-N |
| XLogP | 8.78 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.85 |
| LogP ≤ 5 | 8.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|