C48H84O2 — CID 22964504
[(10S,13S,14R,17R)-4,4,10,13,14-pentamethyl-17-[(2R)-6-methylhept-5-en-2-yl]-2,3,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl] 2-octyldecanoate (PubChem CID 22964504) has the molecular formula C48H84O2 and a molecular weight of 693.20 g/mol. Its IUPAC name is [(10S,13S,14R,17R)-4,4,10,13,14-pentamethyl-17-[(2R)-6-methylhept-5-en-2-yl]-2,3,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl] 2-octyldecanoate.
| Compound Name | [(10S,13S,14R,17R)-4,4,10,13,14-pentamethyl-17-[(2R)-6-methylhept-5-en-2-yl]-2,3,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl] 2-octyldecanoate |
|---|---|
| PubChem CID | 22964504 |
| Molecular Formula | C48H84O2 |
| Molecular Weight | 693.20 g/mol |
| Exact Mass | 692.65 |
| IUPAC Name | [(10S,13S,14R,17R)-4,4,10,13,14-pentamethyl-17-[(2R)-6-methylhept-5-en-2-yl]-2,3,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl] 2-octyldecanoate |
| SMILES | CCCCCCCCC(CCCCCCCC)C(=O)OC1CC[C@]2(C)C3=C(CCC2C1(C)C)[C@]1(C)CC[C@H]([C@H](C)CCC=C(C)C)[C@]1(C)CC3 |
| InChI | InChI=1S/C48H84O2/c1-11-13-15-17-19-21-26-38(27-22-20-18-16-14-12-2)44(49)50-43-32-33-46(8)40-31-35-47(9)39(37(5)25-23-24-36(3)4)30-34-48(47,10)41(40)28-29-42(46)45(43,6)7/h24,37-39,42-43H,11-23,25-35H2,1-10H3/t37-,39-,42?,43?,46-,47+,48+/m1/s1 |
| InChIKey | SEHYUINSBVXCCG-PBZIAOHNSA-N |
| XLogP | 15.15 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.20 |
| LogP ≤ 5 | 15.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|