C48H84O2 — CID 68536369
2-octyl-10-[(10S,13R,14R,17R)-4,4,10,13,14-pentamethyl-17-[(2R)-6-methylhept-5-en-2-yl]-2,3,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl]decanoic acid (PubChem CID 68536369) has the molecular formula C48H84O2 and a molecular weight of 693.20 g/mol. Its IUPAC name is 2-octyl-10-[(10S,13R,14R,17R)-4,4,10,13,14-pentamethyl-17-[(2R)-6-methylhept-5-en-2-yl]-2,3,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl]decanoic acid.
| Compound Name | 2-octyl-10-[(10S,13R,14R,17R)-4,4,10,13,14-pentamethyl-17-[(2R)-6-methylhept-5-en-2-yl]-2,3,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl]decanoic acid |
|---|---|
| PubChem CID | 68536369 |
| Molecular Formula | C48H84O2 |
| Molecular Weight | 693.20 g/mol |
| Exact Mass | 692.65 |
| IUPAC Name | 2-octyl-10-[(10S,13R,14R,17R)-4,4,10,13,14-pentamethyl-17-[(2R)-6-methylhept-5-en-2-yl]-2,3,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl]decanoic acid |
| SMILES | CCCCCCCCC(CCCCCCCCC1CC[C@]2(C)C3=C(CCC2C1(C)C)[C@]1(C)CC[C@H]([C@H](C)CCC=C(C)C)[C@@]1(C)CC3)C(=O)O |
| InChI | InChI=1S/C48H84O2/c1-10-11-12-13-16-19-25-38(44(49)50)26-20-17-14-15-18-21-27-39-30-33-46(7)41-32-35-47(8)40(37(4)24-22-23-36(2)3)31-34-48(47,9)42(41)28-29-43(46)45(39,5)6/h23,37-40,43H,10-22,24-35H2,1-9H3,(H,49,50)/t37-,38?,39?,40-,43?,46-,47-,48+/m1/s1 |
| InChIKey | LJLSYNQCLMUQNV-NKKGAXLKSA-N |
| XLogP | 15.31 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.20 |
| LogP ≤ 5 | 15.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|