C34H58O — CID 69168561
(10S,13R,14R,17R)-2-butyl-4,4,10,13,14-pentamethyl-17-[(2R)-6-methylhept-5-en-2-yl]-2,3,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-ol (PubChem CID 69168561) has the molecular formula C34H58O and a molecular weight of 482.84 g/mol. Its IUPAC name is (10S,13R,14R,17R)-2-butyl-4,4,10,13,14-pentamethyl-17-[(2R)-6-methylhept-5-en-2-yl]-2,3,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-ol.
| Compound Name | (10S,13R,14R,17R)-2-butyl-4,4,10,13,14-pentamethyl-17-[(2R)-6-methylhept-5-en-2-yl]-2,3,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 69168561 |
| Molecular Formula | C34H58O |
| Molecular Weight | 482.84 g/mol |
| Exact Mass | 482.45 |
| IUPAC Name | (10S,13R,14R,17R)-2-butyl-4,4,10,13,14-pentamethyl-17-[(2R)-6-methylhept-5-en-2-yl]-2,3,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-ol |
| SMILES | CCCCC1C[C@]2(C)C3=C(CCC2C(C)(C)C1O)[C@]1(C)CC[C@H]([C@H](C)CCC=C(C)C)[C@@]1(C)CC3 |
| InChI | InChI=1S/C34H58O/c1-10-11-15-25-22-32(7)27-19-21-33(8)26(24(4)14-12-13-23(2)3)18-20-34(33,9)28(27)16-17-29(32)31(5,6)30(25)35/h13,24-26,29-30,35H,10-12,14-22H2,1-9H3/t24-,25?,26-,29?,30?,32-,33-,34+/m1/s1 |
| InChIKey | BUBQJTVZIAYQPO-DHIYONELSA-N |
| XLogP | 9.90 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.84 |
| LogP ≤ 5 | 9.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|