C50H80O2 — CID 90996297
[(10S,13S,14R,17R)-4,4,10,13,14-pentamethyl-17-[(2R)-6-methylhept-5-en-2-yl]-2,3,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl] icosa-5,8,11,14-tetraenoate (PubChem CID 90996297) has the molecular formula C50H80O2 and a molecular weight of 713.19 g/mol. Its IUPAC name is [(10S,13S,14R,17R)-4,4,10,13,14-pentamethyl-17-[(2R)-6-methylhept-5-en-2-yl]-2,3,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl] icosa-5,8,11,14-tetraenoate.
| Compound Name | [(10S,13S,14R,17R)-4,4,10,13,14-pentamethyl-17-[(2R)-6-methylhept-5-en-2-yl]-2,3,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl] icosa-5,8,11,14-tetraenoate |
|---|---|
| PubChem CID | 90996297 |
| Molecular Formula | C50H80O2 |
| Molecular Weight | 713.19 g/mol |
| Exact Mass | 712.62 |
| IUPAC Name | [(10S,13S,14R,17R)-4,4,10,13,14-pentamethyl-17-[(2R)-6-methylhept-5-en-2-yl]-2,3,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl] icosa-5,8,11,14-tetraenoate |
| SMILES | CCCCCC=CCC=CCC=CCC=CCCCC(=O)OC1CC[C@]2(C)C3=C(CCC2C1(C)C)[C@]1(C)CC[C@H]([C@H](C)CCC=C(C)C)[C@]1(C)CC3 |
| InChI | InChI=1S/C50H80O2/c1-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-25-26-30-46(51)52-45-35-36-48(7)42-34-38-49(8)41(40(4)29-27-28-39(2)3)33-37-50(49,9)43(42)31-32-44(48)47(45,5)6/h14-15,17-18,20-21,23-24,28,40-41,44-45H,10-13,16,19,22,25-27,29-38H2,1-9H3/t40-,41-,44?,45?,48-,49+,50+/m1/s1 |
| InChIKey | QSKNWTLFSLDVKJ-RULRUXQDSA-N |
| XLogP | 15.18 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 713.19 |
| LogP ≤ 5 | 15.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|