C30H50O4S — CID 54049103
[(10S,13S,14R,17R)-4,4,10,13,14-pentamethyl-17-[(2R)-6-methylhept-5-en-2-yl]-2,3,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl] hydrogen sulfate (PubChem CID 54049103) has the molecular formula C30H50O4S and a molecular weight of 506.79 g/mol. Its IUPAC name is [(10S,13S,14R,17R)-4,4,10,13,14-pentamethyl-17-[(2R)-6-methylhept-5-en-2-yl]-2,3,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl] hydrogen sulfate.
| Compound Name | [(10S,13S,14R,17R)-4,4,10,13,14-pentamethyl-17-[(2R)-6-methylhept-5-en-2-yl]-2,3,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 54049103 |
| Molecular Formula | C30H50O4S |
| Molecular Weight | 506.79 g/mol |
| Exact Mass | 506.34 |
| IUPAC Name | [(10S,13S,14R,17R)-4,4,10,13,14-pentamethyl-17-[(2R)-6-methylhept-5-en-2-yl]-2,3,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl] hydrogen sulfate |
| SMILES | CC(C)=CCC[C@@H](C)[C@H]1CC[C@@]2(C)C3=C(CC[C@@]12C)[C@@]1(C)CCC(OS(=O)(=O)O)C(C)(C)C1CC3 |
| InChI | InChI=1S/C30H50O4S/c1-20(2)10-9-11-21(3)22-14-18-30(8)24-12-13-25-27(4,5)26(34-35(31,32)33)16-17-28(25,6)23(24)15-19-29(22,30)7/h10,21-22,25-26H,9,11-19H2,1-8H3,(H,31,32,33)/t21-,22-,25?,26?,28-,29+,30+/m1/s1 |
| InChIKey | LRQDALIQPMGIBH-LPZYSZJKSA-N |
| XLogP | 8.31 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.79 |
| LogP ≤ 5 | 8.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|